C15H11ClF2O2 — CID 114714453
6-chloro-2-(2,3-difluorophenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714453) has the molecular formula C15H11ClF2O2 and a molecular weight of 296.70 g/mol. Its IUPAC name is 6-chloro-2-(2,3-difluorophenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-chloro-2-(2,3-difluorophenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714453 |
| Molecular Formula | C15H11ClF2O2 |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 6-chloro-2-(2,3-difluorophenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(c2cccc(F)c2F)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H11ClF2O2/c16-8-4-5-13-10(6-8)12(19)7-14(20-13)9-2-1-3-11(17)15(9)18/h1-6,12,14,19H,7H2 |
| InChIKey | ZHZDEGVWFIQOJH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |