C16H14F2O2 — CID 104950320
(4R)-2-(2,3-difluorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104950320) has the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. Its IUPAC name is (4R)-2-(2,3-difluorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-2-(2,3-difluorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104950320 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (4R)-2-(2,3-difluorophenyl)-6-methyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | Cc1ccc2c(c1)[C@H](O)CC(c1cccc(F)c1F)O2 |
| InChI | InChI=1S/C16H14F2O2/c1-9-5-6-14-11(7-9)13(19)8-15(20-14)10-3-2-4-12(17)16(10)18/h2-7,13,15,19H,8H2,1H3/t13-,15?/m1/s1 |
| InChIKey | HFWREHAJNVAJPX-AFYYWNPRSA-N |
| XLogP | 3.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |