C15H12ClFO2 — CID 114715770
2-(3-chlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715770) has the molecular formula C15H12ClFO2 and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(3-chlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715770 |
| Molecular Formula | C15H12ClFO2 |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-(3-chlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(c2cccc(Cl)c2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C15H12ClFO2/c16-10-3-1-2-9(6-10)14-8-13(18)12-5-4-11(17)7-15(12)19-14/h1-7,13-14,18H,8H2 |
| InChIKey | ZHSCPTFOCWETMH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |