C14H12O2S — CID 102374647
(2S)-2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-ol (PubChem CID 102374647) has the molecular formula C14H12O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is (2S)-2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-ol.
| Compound Name | (2S)-2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-ol |
|---|---|
| PubChem CID | 102374647 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (2S)-2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-ol |
| SMILES | Oc1ccc2c(c1)SC[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C14H12O2S/c15-11-6-7-12-14(8-11)17-9-13(16-12)10-4-2-1-3-5-10/h1-8,13,15H,9H2/t13-/m1/s1 |
| InChIKey | CPSFUCYWQUYUPC-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |