C32H32O8 — CID 161182223
2-(2-methoxyphenyl)-3,4-dihydro-2H-chromene-4,6-diol (PubChem CID 161182223) has the molecular formula C32H32O8 and a molecular weight of 544.60 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3,4-dihydro-2H-chromene-4,6-diol.
| Compound Name | 2-(2-methoxyphenyl)-3,4-dihydro-2H-chromene-4,6-diol |
|---|---|
| PubChem CID | 161182223 |
| Molecular Formula | C32H32O8 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 2-(2-methoxyphenyl)-3,4-dihydro-2H-chromene-4,6-diol |
| SMILES | COc1ccccc1C1CC(O)c2cc(O)ccc2O1.COc1ccccc1C1CC(O)c2cc(O)ccc2O1 |
| InChI | InChI=1S/2C16H16O4/c2*1-19-14-5-3-2-4-11(14)16-9-13(18)12-8-10(17)6-7-15(12)20-16/h2*2-8,13,16-18H,9H2,1H3 |
| InChIKey | USPPWTJZQCSJMC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |