C17H17ClO3 — CID 104949000
(4S)-6-chloro-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949000) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is (4S)-6-chloro-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-6-chloro-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949000 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (4S)-6-chloro-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCOc1ccccc1C1C[C@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C17H17ClO3/c1-2-20-15-6-4-3-5-12(15)17-10-14(19)13-9-11(18)7-8-16(13)21-17/h3-9,14,17,19H,2,10H2,1H3/t14-,17?/m0/s1 |
| InChIKey | SPFSFTGGUXUMQY-MBIQTGHCSA-N |
| XLogP | 4.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |