C17H18O3 — CID 104949924
(4S)-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949924) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (4S)-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949924 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (4S)-2-(2-ethoxyphenyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCOc1ccccc1C1C[C@H](O)c2ccccc2O1 |
| InChI | InChI=1S/C17H18O3/c1-2-19-15-9-5-4-8-13(15)17-11-14(18)12-7-3-6-10-16(12)20-17/h3-10,14,17-18H,2,11H2,1H3/t14-,17?/m0/s1 |
| InChIKey | XUFLYOGBTOWKPI-MBIQTGHCSA-N |
| XLogP | 3.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |