C15H15NO6 — CID 102485846
dimethyl 4-(3-nitrophenyl)cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 102485846) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is dimethyl 4-(3-nitrophenyl)cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 4-(3-nitrophenyl)cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102485846 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | dimethyl 4-(3-nitrophenyl)cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=CC(c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H15NO6/c1-21-13(17)15(14(18)22-2)7-6-11(9-15)10-4-3-5-12(8-10)16(19)20/h3-8,11H,9H2,1-2H3 |
| InChIKey | WZMXBGAVLDZHHG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|