C14H15N3O6 — CID 110273791
methyl 6-(methoxymethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110273791) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is methyl 6-(methoxymethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 6-(methoxymethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110273791 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | methyl 6-(methoxymethyl)-4-(3-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COCC1=C(C(=O)OC)C(c2cccc([N+](=O)[O-])c2)NC(=O)N1 |
| InChI | InChI=1S/C14H15N3O6/c1-22-7-10-11(13(18)23-2)12(16-14(19)15-10)8-4-3-5-9(6-8)17(20)21/h3-6,12H,7H2,1-2H3,(H2,15,16,19) |
| InChIKey | PFRHEIOSZIQEQY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|