C20H16ClN3O7 — CID 95384590
dimethyl (6S)-3-(4-chlorophenyl)-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-4,5-dicarboxylate (PubChem CID 95384590) has the molecular formula C20H16ClN3O7 and a molecular weight of 445.82 g/mol. Its IUPAC name is dimethyl (6S)-3-(4-chlorophenyl)-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-4,5-dicarboxylate.
| Compound Name | dimethyl (6S)-3-(4-chlorophenyl)-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 95384590 |
| Molecular Formula | C20H16ClN3O7 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | dimethyl (6S)-3-(4-chlorophenyl)-6-(3-nitrophenyl)-2-oxo-1,6-dihydropyrimidine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(Cl)cc2)C(=O)N[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16ClN3O7/c1-30-18(25)15-16(11-4-3-5-14(10-11)24(28)29)22-20(27)23(17(15)19(26)31-2)13-8-6-12(21)7-9-13/h3-10,16H,1-2H3,(H,22,27)/t16-/m0/s1 |
| InChIKey | GJIITPITEARHMD-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|