C26H24N2O11 — CID 53473535
tetramethyl 1-(4-methoxyphenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3,5,6-tetracarboxylate (PubChem CID 53473535) has the molecular formula C26H24N2O11 and a molecular weight of 540.48 g/mol. Its IUPAC name is tetramethyl 1-(4-methoxyphenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1-(4-methoxyphenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 53473535 |
| Molecular Formula | C26H24N2O11 |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | tetramethyl 1-(4-methoxyphenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(OC)cc2)C(C(=O)OC)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24N2O11/c1-35-17-11-9-15(10-12-17)27-21(25(31)38-4)19(23(29)36-2)18(14-7-6-8-16(13-14)28(33)34)20(24(30)37-3)22(27)26(32)39-5/h6-13,18H,1-5H3 |
| InChIKey | LCFVJGHPJNJPGL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 160.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|