C24H23ClN4O7 — CID 139222661
diethyl 6-amino-5-carbamoyl-1-(4-chlorophenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3-dicarboxylate (PubChem CID 139222661) has the molecular formula C24H23ClN4O7 and a molecular weight of 514.92 g/mol. Its IUPAC name is diethyl 6-amino-5-carbamoyl-1-(4-chlorophenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3-dicarboxylate.
| Compound Name | diethyl 6-amino-5-carbamoyl-1-(4-chlorophenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139222661 |
| Molecular Formula | C24H23ClN4O7 |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | diethyl 6-amino-5-carbamoyl-1-(4-chlorophenyl)-4-(3-nitrophenyl)-4H-pyridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(c2ccc(Cl)cc2)C(N)=C(C(N)=O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23ClN4O7/c1-3-35-23(31)18-17(13-6-5-7-16(12-13)29(33)34)19(22(27)30)21(26)28(20(18)24(32)36-4-2)15-10-8-14(25)9-11-15/h5-12,17H,3-4,26H2,1-2H3,(H2,27,30) |
| InChIKey | HLJNODQWGHGNHJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 168.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|