C20H21N3O7S — CID 2224098
diethyl (2S,7S)-5-amino-2-methyl-7-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate (PubChem CID 2224098) has the molecular formula C20H21N3O7S and a molecular weight of 447.47 g/mol. Its IUPAC name is diethyl (2S,7S)-5-amino-2-methyl-7-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate.
| Compound Name | diethyl (2S,7S)-5-amino-2-methyl-7-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 2224098 |
| Molecular Formula | C20H21N3O7S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | diethyl (2S,7S)-5-amino-2-methyl-7-(3-nitrophenyl)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N2C(=O)[C@H](C)SC2=C(C(=O)OCC)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N3O7S/c1-4-29-19(25)14-13(11-7-6-8-12(9-11)23(27)28)15(20(26)30-5-2)18-22(16(14)21)17(24)10(3)31-18/h6-10,13H,4-5,21H2,1-3H3/t10-,13-/m0/s1 |
| InChIKey | ZTBSXRKQIXLYFX-GWCFXTLKSA-N |
| XLogP | 2.16 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|