C19H19N3O8S — CID 17272839
6-O-ethyl 8-O-methyl 5-amino-7-(2-hydroxy-5-nitrophenyl)-2-methyl-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate (PubChem CID 17272839) has the molecular formula C19H19N3O8S and a molecular weight of 449.44 g/mol. Its IUPAC name is 6-O-ethyl 8-O-methyl 5-amino-7-(2-hydroxy-5-nitrophenyl)-2-methyl-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate.
| Compound Name | 6-O-ethyl 8-O-methyl 5-amino-7-(2-hydroxy-5-nitrophenyl)-2-methyl-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 17272839 |
| Molecular Formula | C19H19N3O8S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 6-O-ethyl 8-O-methyl 5-amino-7-(2-hydroxy-5-nitrophenyl)-2-methyl-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(N)N2C(=O)C(C)SC2=C(C(=O)OC)C1c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C19H19N3O8S/c1-4-30-19(26)13-12(10-7-9(22(27)28)5-6-11(10)23)14(18(25)29-3)17-21(15(13)20)16(24)8(2)31-17/h5-8,12,23H,4,20H2,1-3H3 |
| InChIKey | AJWDXEWXJVDZPB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 162.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|