C20H24N2O6 — CID 3995516
diethyl 4-(3-nitrophenyl)-1-propan-2-yl-4H-pyridine-3,5-dicarboxylate (PubChem CID 3995516) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is diethyl 4-(3-nitrophenyl)-1-propan-2-yl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3-nitrophenyl)-1-propan-2-yl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 3995516 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | diethyl 4-(3-nitrophenyl)-1-propan-2-yl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(C(C)C)C=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N2O6/c1-5-27-19(23)16-11-21(13(3)4)12-17(20(24)28-6-2)18(16)14-8-7-9-15(10-14)22(25)26/h7-13,18H,5-6H2,1-4H3 |
| InChIKey | ITIBCWOMDIADOQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|