C26H24N2O7 — CID 70388043
3-O-ethyl 5-O-methyl 1-methyl-4-(3-nitrophenyl)-2-[(E)-3-oxo-3-phenylprop-1-enyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 70388043) has the molecular formula C26H24N2O7 and a molecular weight of 476.49 g/mol. Its IUPAC name is 3-O-ethyl 5-O-methyl 1-methyl-4-(3-nitrophenyl)-2-[(E)-3-oxo-3-phenylprop-1-enyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 3-O-ethyl 5-O-methyl 1-methyl-4-(3-nitrophenyl)-2-[(E)-3-oxo-3-phenylprop-1-enyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70388043 |
| Molecular Formula | C26H24N2O7 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 3-O-ethyl 5-O-methyl 1-methyl-4-(3-nitrophenyl)-2-[(E)-3-oxo-3-phenylprop-1-enyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(/C=C/C(=O)c2ccccc2)N(C)C=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H24N2O7/c1-4-35-26(31)24-21(13-14-22(29)17-9-6-5-7-10-17)27(2)16-20(25(30)34-3)23(24)18-11-8-12-19(15-18)28(32)33/h5-16,23H,4H2,1-3H3/b14-13+ |
| InChIKey | HCAGJENBPZQSTJ-BUHFOSPRSA-N |
| XLogP | 3.94 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|