C21H26N2O10 — CID 70357869
bis(2,3-dihydroxypropyl) 1,2-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 70357869) has the molecular formula C21H26N2O10 and a molecular weight of 466.44 g/mol. Its IUPAC name is bis(2,3-dihydroxypropyl) 1,2-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | bis(2,3-dihydroxypropyl) 1,2-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70357869 |
| Molecular Formula | C21H26N2O10 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | bis(2,3-dihydroxypropyl) 1,2-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCC(O)CO)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC(O)CO)=CN1C |
| InChI | InChI=1S/C21H26N2O10/c1-12-18(21(29)33-11-16(27)9-25)19(13-4-3-5-14(6-13)23(30)31)17(7-22(12)2)20(28)32-10-15(26)8-24/h3-7,15-16,19,24-27H,8-11H2,1-2H3 |
| InChIKey | MHWNOHDVFGQFCP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 179.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|