C22H28N2O8S — CID 19831130
diethyl 2-(2,3-dihydroxypropylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19831130) has the molecular formula C22H28N2O8S and a molecular weight of 480.54 g/mol. Its IUPAC name is diethyl 2-(2,3-dihydroxypropylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(2,3-dihydroxypropylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19831130 |
| Molecular Formula | C22H28N2O8S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | diethyl 2-(2,3-dihydroxypropylsulfanylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(CSCC(O)CO)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H28N2O8S/c1-4-31-21(27)18-13(3)23-17(12-33-11-16(26)10-25)20(22(28)32-5-2)19(18)14-7-6-8-15(9-14)24(29)30/h6-9,16,19,23,25-26H,4-5,10-12H2,1-3H3 |
| InChIKey | KURBOXAVRVSTMW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|