C23H29N2O7Y- — CID 161228370
3-O-(2-methoxyethyl) 5-O-propan-2-yl 1-ethyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate;yttrium (PubChem CID 161228370) has the molecular formula C23H29N2O7Y- and a molecular weight of 534.40 g/mol. Its IUPAC name is 3-O-(2-methoxyethyl) 5-O-propan-2-yl 1-ethyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate;yttrium.
| Compound Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 1-ethyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate;yttrium |
|---|---|
| PubChem CID | 161228370 |
| Molecular Formula | C23H29N2O7Y- |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 1-ethyl-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate;yttrium |
| SMILES | C[CH-]N1C(C)=C(C(=O)OCCOC)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C1C.[Y] |
| InChI | InChI=1S/C23H29N2O7.Y/c1-7-24-15(4)19(22(26)31-12-11-30-6)21(17-9-8-10-18(13-17)25(28)29)20(16(24)5)23(27)32-14(2)3;/h7-10,13-14,21H,11-12H2,1-6H3;/q-1; |
| InChIKey | WSKKOWKARGHCTP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|