C33H44N4O14 — CID 142287455
1-O-[[5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate (PubChem CID 142287455) has the molecular formula C33H44N4O14 and a molecular weight of 720.73 g/mol. Its IUPAC name is 1-O-[[5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate.
| Compound Name | 1-O-[[5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 142287455 |
| Molecular Formula | C33H44N4O14 |
| Molecular Weight | 720.73 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | 1-O-[[5-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoyl]oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C(=O)OCOC(=O)CCC(NC(=O)OC(C)(C)C)C(N)=O)C(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H44N4O14/c1-18(2)50-30(41)26-20(4)36(32(43)49-17-48-24(38)13-12-23(28(34)39)35-31(42)51-33(5,6)7)19(3)25(29(40)47-15-14-46-8)27(26)21-10-9-11-22(16-21)37(44)45/h9-11,16,18,23,27H,12-15,17H2,1-8H3,(H2,34,39)(H,35,42) |
| InChIKey | YZVFCZIXRFMHAW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 242.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|