C27H34N2O11 — CID 142287426
3-O-(2-methoxyethyl) 1-O-(1-propanoyloxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate (PubChem CID 142287426) has the molecular formula C27H34N2O11 and a molecular weight of 562.57 g/mol. Its IUPAC name is 3-O-(2-methoxyethyl) 1-O-(1-propanoyloxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate.
| Compound Name | 3-O-(2-methoxyethyl) 1-O-(1-propanoyloxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 142287426 |
| Molecular Formula | C27H34N2O11 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 3-O-(2-methoxyethyl) 1-O-(1-propanoyloxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
| SMILES | CCC(=O)OC(C)OC(=O)N1C(C)=C(C(=O)OCCOC)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C1C |
| InChI | InChI=1S/C27H34N2O11/c1-8-21(30)39-18(6)40-27(33)28-16(4)22(25(31)37-13-12-36-7)24(19-10-9-11-20(14-19)29(34)35)23(17(28)5)26(32)38-15(2)3/h9-11,14-15,18,24H,8,12-13H2,1-7H3 |
| InChIKey | PXGRAAMLINOUSZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 160.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|