C28H43N4O13P — CID 161036070
(2S)-2,6-diaminohexanoic acid;3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1-(phosphonooxymethyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 161036070) has the molecular formula C28H43N4O13P and a molecular weight of 674.64 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1-(phosphonooxymethyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | (2S)-2,6-diaminohexanoic acid;3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1-(phosphonooxymethyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 161036070 |
| Molecular Formula | C28H43N4O13P |
| Molecular Weight | 674.64 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1-(phosphonooxymethyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(COP(=O)(O)O)C(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C22H29N2O11P.C6H14N2O2/c1-13(2)35-22(26)19-15(4)23(12-34-36(29,30)31)14(3)18(21(25)33-10-9-32-5)20(19)16-7-6-8-17(11-16)24(27)28;7-4-2-1-3-5(8)6(9)10/h6-8,11,13,20H,9-10,12H2,1-5H3,(H2,29,30,31);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | UAGNIHGVFFBZTI-ZSCHJXSPSA-N |
| XLogP | 2.28 |
| TPSA | 264.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|