C24H29ClN2O9 — CID 140930689
1-O-(1-chloroethyl) 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate (PubChem CID 140930689) has the molecular formula C24H29ClN2O9 and a molecular weight of 524.95 g/mol. Its IUPAC name is 1-O-(1-chloroethyl) 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate.
| Compound Name | 1-O-(1-chloroethyl) 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 140930689 |
| Molecular Formula | C24H29ClN2O9 |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 1-O-(1-chloroethyl) 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C(=O)OC(C)Cl)C(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H29ClN2O9/c1-13(2)35-23(29)20-15(4)26(24(30)36-16(5)25)14(3)19(22(28)34-11-10-33-6)21(20)17-8-7-9-18(12-17)27(31)32/h7-9,12-13,16,21H,10-11H2,1-6H3 |
| InChIKey | MMPPIHYGBDPTAA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|