C28H37N2O15P — CID 175070621
3-O-(2-methoxyethyl) 1-O-(5-phosphonooxypentanoyloxymethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate (PubChem CID 175070621) has the molecular formula C28H37N2O15P and a molecular weight of 672.58 g/mol. Its IUPAC name is 3-O-(2-methoxyethyl) 1-O-(5-phosphonooxypentanoyloxymethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate.
| Compound Name | 3-O-(2-methoxyethyl) 1-O-(5-phosphonooxypentanoyloxymethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 175070621 |
| Molecular Formula | C28H37N2O15P |
| Molecular Weight | 672.58 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | 3-O-(2-methoxyethyl) 1-O-(5-phosphonooxypentanoyloxymethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C(=O)OCOC(=O)CCCCOP(=O)(O)O)C(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H37N2O15P/c1-17(2)45-27(33)24-19(4)29(28(34)43-16-42-22(31)11-6-7-12-44-46(37,38)39)18(3)23(26(32)41-14-13-40-5)25(24)20-9-8-10-21(15-20)30(35)36/h8-10,15,17,25H,6-7,11-14,16H2,1-5H3,(H2,37,38,39) |
| InChIKey | WYWUGJRUKTXWSO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 227.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|