C27H37N3O11 — CID 142287425
1-O-[(2-aminoacetyl)oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate;ethane (PubChem CID 142287425) has the molecular formula C27H37N3O11 and a molecular weight of 579.60 g/mol. Its IUPAC name is 1-O-[(2-aminoacetyl)oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate;ethane.
| Compound Name | 1-O-[(2-aminoacetyl)oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate;ethane |
|---|---|
| PubChem CID | 142287425 |
| Molecular Formula | C27H37N3O11 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 1-O-[(2-aminoacetyl)oxymethyl] 3-O-(2-methoxyethyl) 5-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-1,3,5-tricarboxylate;ethane |
| SMILES | CC.COCCOC(=O)C1=C(C)N(C(=O)OCOC(=O)CN)C(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H31N3O11.C2H6/c1-14(2)39-24(31)21-16(4)27(25(32)38-13-37-19(29)12-26)15(3)20(23(30)36-10-9-35-5)22(21)17-7-6-8-18(11-17)28(33)34;1-2/h6-8,11,14,22H,9-10,12-13,26H2,1-5H3;1-2H3 |
| InChIKey | LODBEJZOIKRTAZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 186.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|