C24H31N3O7 — CID 70074666
propan-2-yl 2,6-dimethyl-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70074666) has the molecular formula C24H31N3O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is propan-2-yl 2,6-dimethyl-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | propan-2-yl 2,6-dimethyl-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70074666 |
| Molecular Formula | C24H31N3O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | propan-2-yl 2,6-dimethyl-5-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]carbamoyl]-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)NCC(=O)OC(C)(C)C)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C24H31N3O7/c1-13(2)33-23(30)20-15(4)26-14(3)19(22(29)25-12-18(28)34-24(5,6)7)21(20)16-9-8-10-17(11-16)27(31)32/h8-11,13,21,26H,12H2,1-7H3,(H,25,29) |
| InChIKey | UXRFJESYZILBRF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|