C14H13N3O6 — CID 141094936
1-amino-2-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 141094936) has the molecular formula C14H13N3O6 and a molecular weight of 319.27 g/mol. Its IUPAC name is 1-amino-2-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-amino-2-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 141094936 |
| Molecular Formula | C14H13N3O6 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-amino-2-methyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=CN1N |
| InChI | InChI=1S/C14H13N3O6/c1-7-11(14(20)21)12(10(13(18)19)6-16(7)15)8-3-2-4-9(5-8)17(22)23/h2-6,12H,15H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | KAAJTHFYEBGDFJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|