C21H17N3O8 — CID 150974896
2-methyl-4-(3-nitrophenyl)-1-[(2-nitrophenyl)methyl]-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 150974896) has the molecular formula C21H17N3O8 and a molecular weight of 439.38 g/mol. Its IUPAC name is 2-methyl-4-(3-nitrophenyl)-1-[(2-nitrophenyl)methyl]-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-methyl-4-(3-nitrophenyl)-1-[(2-nitrophenyl)methyl]-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 150974896 |
| Molecular Formula | C21H17N3O8 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-methyl-4-(3-nitrophenyl)-1-[(2-nitrophenyl)methyl]-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=CN1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O8/c1-12-18(21(27)28)19(13-6-4-7-15(9-13)23(29)30)16(20(25)26)11-22(12)10-14-5-2-3-8-17(14)24(31)32/h2-9,11,19H,10H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | LOWRZRARVCPSPO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|