C13H11N3O6 — CID 21486008
2-amino-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 21486008) has the molecular formula C13H11N3O6 and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-amino-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 21486008 |
| Molecular Formula | C13H11N3O6 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-amino-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | NC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=CN1 |
| InChI | InChI=1S/C13H11N3O6/c14-11-10(13(19)20)9(8(5-15-11)12(17)18)6-2-1-3-7(4-6)16(21)22/h1-5,9,15H,14H2,(H,17,18)(H,19,20) |
| InChIKey | LYHMHDVXIRUTKC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|