C18H19N5O7 — CID 161433795
hydrazine;4-(3-nitrophenyl)-6-phenyl-1,4-dihydropyridazine-3,5-dicarboxylic acid;hydrate (PubChem CID 161433795) has the molecular formula C18H19N5O7 and a molecular weight of 417.38 g/mol. Its IUPAC name is hydrazine;4-(3-nitrophenyl)-6-phenyl-1,4-dihydropyridazine-3,5-dicarboxylic acid;hydrate.
| Compound Name | hydrazine;4-(3-nitrophenyl)-6-phenyl-1,4-dihydropyridazine-3,5-dicarboxylic acid;hydrate |
|---|---|
| PubChem CID | 161433795 |
| Molecular Formula | C18H19N5O7 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | hydrazine;4-(3-nitrophenyl)-6-phenyl-1,4-dihydropyridazine-3,5-dicarboxylic acid;hydrate |
| SMILES | NN.O.O=C(O)C1=NNC(c2ccccc2)=C(C(=O)O)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N3O6.H4N2.H2O/c22-17(23)14-13(11-7-4-8-12(9-11)21(26)27)16(18(24)25)20-19-15(14)10-5-2-1-3-6-10;1-2;/h1-9,13,19H,(H,22,23)(H,24,25);1-2H2;1H2 |
| InChIKey | ULKOVOGAIKFDBB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 225.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|