C43H32N6O4 — CID 100924951
3-(3-nitrophenyl)-4-[9-[3-(3-nitrophenyl)-5-phenyl-2,3-dihydro-1H-pyrazol-4-yl]fluoren-9-yl]-5-phenyl-2,3-dihydro-1H-pyrazole (PubChem CID 100924951) has the molecular formula C43H32N6O4 and a molecular weight of 696.77 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-4-[9-[3-(3-nitrophenyl)-5-phenyl-2,3-dihydro-1H-pyrazol-4-yl]fluoren-9-yl]-5-phenyl-2,3-dihydro-1H-pyrazole.
| Compound Name | 3-(3-nitrophenyl)-4-[9-[3-(3-nitrophenyl)-5-phenyl-2,3-dihydro-1H-pyrazol-4-yl]fluoren-9-yl]-5-phenyl-2,3-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 100924951 |
| Molecular Formula | C43H32N6O4 |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | 3-(3-nitrophenyl)-4-[9-[3-(3-nitrophenyl)-5-phenyl-2,3-dihydro-1H-pyrazol-4-yl]fluoren-9-yl]-5-phenyl-2,3-dihydro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1cccc(C2NNC(c3ccccc3)=C2C2(C3=C(c4ccccc4)NNC3c3cccc([N+](=O)[O-])c3)c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C43H32N6O4/c50-48(51)31-19-11-17-29(25-31)41-37(39(44-46-41)27-13-3-1-4-14-27)43(35-23-9-7-21-33(35)34-22-8-10-24-36(34)43)38-40(28-15-5-2-6-16-28)45-47-42(38)30-18-12-20-32(26-30)49(52)53/h1-26,41-42,44-47H |
| InChIKey | UOCXUOOTUFOEHQ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|