C27H21NO2 — CID 135029071
1-(3-nitrophenyl)-3,3-diphenyl-1,2-dihydroindene (PubChem CID 135029071) has the molecular formula C27H21NO2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3,3-diphenyl-1,2-dihydroindene.
| Compound Name | 1-(3-nitrophenyl)-3,3-diphenyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 135029071 |
| Molecular Formula | C27H21NO2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-(3-nitrophenyl)-3,3-diphenyl-1,2-dihydroindene |
| SMILES | O=[N+]([O-])c1cccc(C2CC(c3ccccc3)(c3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C27H21NO2/c29-28(30)23-15-9-10-20(18-23)25-19-27(21-11-3-1-4-12-21,22-13-5-2-6-14-22)26-17-8-7-16-24(25)26/h1-18,25H,19H2 |
| InChIKey | XPMMZHHZFIRBES-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|