C31H23N3O2 — CID 15440931
3-(4-nitrophenyl)-1,5-diphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene (PubChem CID 15440931) has the molecular formula C31H23N3O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1,5-diphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene.
| Compound Name | 3-(4-nitrophenyl)-1,5-diphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene |
|---|---|
| PubChem CID | 15440931 |
| Molecular Formula | C31H23N3O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3-(4-nitrophenyl)-1,5-diphenyl-4,5-diazatetracyclo[6.6.1.02,6.09,14]pentadeca-2(6),3,9,11,13-pentaene |
| SMILES | O=[N+]([O-])c1ccc(-c2nn(-c3ccccc3)c3c2C2(c4ccccc4)CC(C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C31H23N3O2/c35-34(36)25-17-15-21(16-18-25)30-29-28(33(32-30)24-11-5-2-6-12-24)19-22-20-31(29,23-9-3-1-4-10-23)27-14-8-7-13-26(22)27/h1-18,22H,19-20H2 |
| InChIKey | RMYCMOLMPKXDSU-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|