C24H17N5O5 — CID 135620940
4-(3-nitrophenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135620940) has the molecular formula C24H17N5O5 and a molecular weight of 455.43 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 4-(3-nitrophenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135620940 |
| Molecular Formula | C24H17N5O5 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-(3-nitrophenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | O=C1CC(c2cccc([N+](=O)[O-])c2)c2c(-c3ccccc3)nn(-c3ccc([N+](=O)[O-])cc3)c2N1 |
| InChI | InChI=1S/C24H17N5O5/c30-21-14-20(16-7-4-8-19(13-16)29(33)34)22-23(15-5-2-1-3-6-15)26-27(24(22)25-21)17-9-11-18(12-10-17)28(31)32/h1-13,20H,14H2,(H,25,30) |
| InChIKey | NODKZZJZVSHKRZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|