C25H20N4O3S — CID 135620963
4-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135620963) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 4-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 4-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135620963 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 4-(4-methylsulfanylphenyl)-1-(4-nitrophenyl)-3-phenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CSc1ccc(C2CC(=O)Nc3c2c(-c2ccccc2)nn3-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H20N4O3S/c1-33-20-13-7-16(8-14-20)21-15-22(30)26-25-23(21)24(17-5-3-2-4-6-17)27-28(25)18-9-11-19(12-10-18)29(31)32/h2-14,21H,15H2,1H3,(H,26,30) |
| InChIKey | JPOALTRDGWBRGG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|