C27H19N3O2 — CID 59515058
1-(4-nitrophenyl)-3,4,5-triphenylpyrazole (PubChem CID 59515058) has the molecular formula C27H19N3O2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-3,4,5-triphenylpyrazole.
| Compound Name | 1-(4-nitrophenyl)-3,4,5-triphenylpyrazole |
|---|---|
| PubChem CID | 59515058 |
| Molecular Formula | C27H19N3O2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-(4-nitrophenyl)-3,4,5-triphenylpyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H19N3O2/c31-30(32)24-18-16-23(17-19-24)29-27(22-14-8-3-9-15-22)25(20-10-4-1-5-11-20)26(28-29)21-12-6-2-7-13-21/h1-19H |
| InChIKey | WPPBEROKLJSVQT-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|