C17H12N4O4 — CID 541184
3-acetyl-1-(4-nitrophenyl)-5-phenyl-1,2,4-triazin-6-one (PubChem CID 541184) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 3-acetyl-1-(4-nitrophenyl)-5-phenyl-1,2,4-triazin-6-one.
| Compound Name | 3-acetyl-1-(4-nitrophenyl)-5-phenyl-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 541184 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-acetyl-1-(4-nitrophenyl)-5-phenyl-1,2,4-triazin-6-one |
| SMILES | CC(=O)c1nc(-c2ccccc2)c(=O)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C17H12N4O4/c1-11(22)16-18-15(12-5-3-2-4-6-12)17(23)20(19-16)13-7-9-14(10-8-13)21(24)25/h2-10H,1H3 |
| InChIKey | GZUDBDUXBZCUEC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|