C17H13N5O5 — CID 155927443
2-[[1-(4-nitrophenyl)-5-phenyl-1,2,4-triazole-3-carbonyl]amino]acetic acid (PubChem CID 155927443) has the molecular formula C17H13N5O5 and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-[[1-(4-nitrophenyl)-5-phenyl-1,2,4-triazole-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-(4-nitrophenyl)-5-phenyl-1,2,4-triazole-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 155927443 |
| Molecular Formula | C17H13N5O5 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[[1-(4-nitrophenyl)-5-phenyl-1,2,4-triazole-3-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1nc(-c2ccccc2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C17H13N5O5/c23-14(24)10-18-17(25)15-19-16(11-4-2-1-3-5-11)21(20-15)12-6-8-13(9-7-12)22(26)27/h1-9H,10H2,(H,18,25)(H,23,24) |
| InChIKey | DYISJKDLMAKSAS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|