C23H18N6O — CID 112791039
N-(1H-benzimidazol-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 112791039) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 112791039 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18N6O/c30-23(24-15-20-25-18-13-7-8-14-19(18)26-20)21-27-22(16-9-3-1-4-10-16)29(28-21)17-11-5-2-6-12-17/h1-14H,15H2,(H,24,30)(H,25,26) |
| InChIKey | DWQALWHXORQIGA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |