C23H20N4O2 — CID 112771643
N-(2-hydroxy-2-phenylethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 112771643) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 112771643 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCC(O)c1ccccc1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H20N4O2/c28-20(17-10-4-1-5-11-17)16-24-23(29)21-25-22(18-12-6-2-7-13-18)27(26-21)19-14-8-3-9-15-19/h1-15,20,28H,16H2,(H,24,29) |
| InChIKey | RFLWNTHFCFCNCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |