C24H20N4O3 — CID 71240288
(3S)-3-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 71240288) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is (3S)-3-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 71240288 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (3S)-3-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H20N4O3/c29-21(30)16-20(17-10-4-1-5-11-17)25-24(31)22-26-23(18-12-6-2-7-13-18)28(27-22)19-14-8-3-9-15-19/h1-15,20H,16H2,(H,25,31)(H,29,30)/t20-/m0/s1 |
| InChIKey | DLJSSZDQEOECCT-FQEVSTJZSA-N |
| XLogP | 3.88 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |