C25H20N8O2 — CID 46652364
N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-5-methyl-2-phenyltriazole-4-carbohydrazide (PubChem CID 46652364) has the molecular formula C25H20N8O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-5-methyl-2-phenyltriazole-4-carbohydrazide.
| Compound Name | N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-5-methyl-2-phenyltriazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46652364 |
| Molecular Formula | C25H20N8O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N'-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-5-methyl-2-phenyltriazole-4-carbohydrazide |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)NNC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H20N8O2/c1-17-21(30-33(29-17)20-15-9-4-10-16-20)24(34)27-28-25(35)22-26-23(18-11-5-2-6-12-18)32(31-22)19-13-7-3-8-14-19/h2-16H,1H3,(H,27,34)(H,28,35) |
| InChIKey | BFYUJBAOWZFRSO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|