C20H17Cl2N5O2 — CID 46666855
N'-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide (PubChem CID 46666855) has the molecular formula C20H17Cl2N5O2 and a molecular weight of 430.30 g/mol. Its IUPAC name is N'-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide.
| Compound Name | N'-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46666855 |
| Molecular Formula | C20H17Cl2N5O2 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N'-(2,2-dichloro-1-methylcyclopropanecarbonyl)-1,5-diphenyl-1,2,4-triazole-3-carbohydrazide |
| SMILES | CC1(C(=O)NNC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)CC1(Cl)Cl |
| InChI | InChI=1S/C20H17Cl2N5O2/c1-19(12-20(19,21)22)18(29)25-24-17(28)15-23-16(13-8-4-2-5-9-13)27(26-15)14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | UTQVDIMFSRFXOD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|