C23H18N6O2 — CID 38041824
1,5-diphenyl-N'-[(E)-3-pyridin-3-ylprop-2-enoyl]-1,2,4-triazole-3-carbohydrazide (PubChem CID 38041824) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 1,5-diphenyl-N'-[(E)-3-pyridin-3-ylprop-2-enoyl]-1,2,4-triazole-3-carbohydrazide.
| Compound Name | 1,5-diphenyl-N'-[(E)-3-pyridin-3-ylprop-2-enoyl]-1,2,4-triazole-3-carbohydrazide |
|---|---|
| PubChem CID | 38041824 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1,5-diphenyl-N'-[(E)-3-pyridin-3-ylprop-2-enoyl]-1,2,4-triazole-3-carbohydrazide |
| SMILES | O=C(/C=C/c1cccnc1)NNC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H18N6O2/c30-20(14-13-17-8-7-15-24-16-17)26-27-23(31)21-25-22(18-9-3-1-4-10-18)29(28-21)19-11-5-2-6-12-19/h1-16H,(H,26,30)(H,27,31)/b14-13+ |
| InChIKey | SVWIKMRBEHXHNM-BUHFOSPRSA-N |
| XLogP | 2.80 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|