C24H19N5O — CID 3378020
N-(cinnamylideneamino)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 3378020) has the molecular formula C24H19N5O and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(cinnamylideneamino)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(cinnamylideneamino)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 3378020 |
| Molecular Formula | C24H19N5O |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(cinnamylideneamino)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NN=CC=Cc1ccccc1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H19N5O/c30-24(27-25-18-10-13-19-11-4-1-5-12-19)22-26-23(20-14-6-2-7-15-20)29(28-22)21-16-8-3-9-17-21/h1-18H,(H,27,30) |
| InChIKey | GIQFACJYJDEQDF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|