C36H25N5O5 — CID 6035541
[2-benzoyloxy-4-[(Z)-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 6035541) has the molecular formula C36H25N5O5 and a molecular weight of 607.63 g/mol. Its IUPAC name is [2-benzoyloxy-4-[(Z)-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-benzoyloxy-4-[(Z)-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 6035541 |
| Molecular Formula | C36H25N5O5 |
| Molecular Weight | 607.63 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | [2-benzoyloxy-4-[(Z)-[(1,5-diphenyl-1,2,4-triazole-3-carbonyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(/C=N\NC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)cc1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H25N5O5/c42-34(32-38-33(26-13-5-1-6-14-26)41(40-32)29-19-11-4-12-20-29)39-37-24-25-21-22-30(45-35(43)27-15-7-2-8-16-27)31(23-25)46-36(44)28-17-9-3-10-18-28/h1-24H,(H,39,42)/b37-24- |
| InChIKey | GFYZYPQIKXEDEB-PNEAAFPUSA-N |
| XLogP | 6.14 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|