C22H15BrClN5O2 — CID 135685370
N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 135685370) has the molecular formula C22H15BrClN5O2 and a molecular weight of 496.75 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 135685370 |
| Molecular Formula | C22H15BrClN5O2 |
| Molecular Weight | 496.75 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Cl)cc(Br)c1O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H15BrClN5O2/c23-18-12-16(24)11-15(19(18)30)13-25-27-22(31)20-26-21(14-7-3-1-4-8-14)29(28-20)17-9-5-2-6-10-17/h1-13,30H,(H,27,31)/b25-13+ |
| InChIKey | VNDHRDCKRBAWIB-DHRITJCHSA-N |
| XLogP | 4.82 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|