C18H13BrClN3O2 — CID 135957404
N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-4-carboxamide (PubChem CID 135957404) has the molecular formula C18H13BrClN3O2 and a molecular weight of 418.68 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-4-carboxamide.
| Compound Name | N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 135957404 |
| Molecular Formula | C18H13BrClN3O2 |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | N-[(E)-(3-bromo-5-chloro-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C/c2cc(Cl)cc(Br)c2O)c2ccccc2n1 |
| InChI | InChI=1S/C18H13BrClN3O2/c1-10-6-14(13-4-2-3-5-16(13)22-10)18(25)23-21-9-11-7-12(20)8-15(19)17(11)24/h2-9,24H,1H3,(H,23,25)/b21-9+ |
| InChIKey | BSVYWDFIOKTQOK-ZVBGSRNCSA-N |
| XLogP | 4.43 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|