C18H13F2N3O — CID 43012024
N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-methylquinoline-4-carboxamide (PubChem CID 43012024) has the molecular formula C18H13F2N3O and a molecular weight of 325.32 g/mol. Its IUPAC name is N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-methylquinoline-4-carboxamide.
| Compound Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 43012024 |
| Molecular Formula | C18H13F2N3O |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C/c2ccc(F)c(F)c2)c2ccccc2n1 |
| InChI | InChI=1S/C18H13F2N3O/c1-11-8-14(13-4-2-3-5-17(13)22-11)18(24)23-21-10-12-6-7-15(19)16(20)9-12/h2-10H,1H3,(H,23,24)/b21-10+ |
| InChIKey | BHYIHNBPOMYHFB-UFFVCSGVSA-N |
| XLogP | 3.59 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|