C24H20ClN5O3 — CID 46804502
N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 46804502) has the molecular formula C24H20ClN5O3 and a molecular weight of 461.91 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 46804502 |
| Molecular Formula | C24H20ClN5O3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)cc(Cl)c1OC |
| InChI | InChI=1S/C24H20ClN5O3/c1-32-20-14-16(13-19(25)21(20)33-2)15-26-28-24(31)22-27-23(17-9-5-3-6-10-17)30(29-22)18-11-7-4-8-12-18/h3-15H,1-2H3,(H,28,31)/b26-15+ |
| InChIKey | GZNQYSCXHBMQOV-CVKSISIWSA-N |
| XLogP | 4.37 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|